C19H24ClN3O2 — CID 119559628
N-(2-piperidin-3-ylethyl)-4-(1H-pyrrole-3-carbonyl)benzamide;hydrochloride (PubChem CID 119559628) has the molecular formula C19H24ClN3O2 and a molecular weight of 361.87 g/mol. Its IUPAC name is N-(2-piperidin-3-ylethyl)-4-(1H-pyrrole-3-carbonyl)benzamide;hydrochloride.
| Compound Name | N-(2-piperidin-3-ylethyl)-4-(1H-pyrrole-3-carbonyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119559628 |
| Molecular Formula | C19H24ClN3O2 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N-(2-piperidin-3-ylethyl)-4-(1H-pyrrole-3-carbonyl)benzamide;hydrochloride |
| SMILES | Cl.O=C(NCCC1CCCNC1)c1ccc(C(=O)c2cc[nH]c2)cc1 |
| InChI | InChI=1S/C19H23N3O2.ClH/c23-18(17-8-10-21-13-17)15-3-5-16(6-4-15)19(24)22-11-7-14-2-1-9-20-12-14;/h3-6,8,10,13-14,20-21H,1-2,7,9,11-12H2,(H,22,24);1H |
| InChIKey | AOWXRKFTPPONQJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |