C20H24N2O3S2 — CID 49189674
N-cyclohexyl-4-[(4-methylsulfanylphenyl)sulfonylamino]benzamide (PubChem CID 49189674) has the molecular formula C20H24N2O3S2 and a molecular weight of 404.56 g/mol. Its IUPAC name is N-cyclohexyl-4-[(4-methylsulfanylphenyl)sulfonylamino]benzamide.
| Compound Name | N-cyclohexyl-4-[(4-methylsulfanylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 49189674 |
| Molecular Formula | C20H24N2O3S2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | N-cyclohexyl-4-[(4-methylsulfanylphenyl)sulfonylamino]benzamide |
| SMILES | CSc1ccc(S(=O)(=O)Nc2ccc(C(=O)NC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C20H24N2O3S2/c1-26-18-11-13-19(14-12-18)27(24,25)22-17-9-7-15(8-10-17)20(23)21-16-5-3-2-4-6-16/h7-14,16,22H,2-6H2,1H3,(H,21,23) |
| InChIKey | LEHGRWSUCOVGTE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |