C16H15ClFN3O3S — CID 134040540
1-[4-[(2-chloro-4-fluorophenyl)sulfonylamino]phenyl]-3-cyclopropylurea (PubChem CID 134040540) has the molecular formula C16H15ClFN3O3S and a molecular weight of 383.83 g/mol. Its IUPAC name is 1-[4-[(2-chloro-4-fluorophenyl)sulfonylamino]phenyl]-3-cyclopropylurea.
| Compound Name | 1-[4-[(2-chloro-4-fluorophenyl)sulfonylamino]phenyl]-3-cyclopropylurea |
|---|---|
| PubChem CID | 134040540 |
| Molecular Formula | C16H15ClFN3O3S |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 1-[4-[(2-chloro-4-fluorophenyl)sulfonylamino]phenyl]-3-cyclopropylurea |
| SMILES | O=C(Nc1ccc(NS(=O)(=O)c2ccc(F)cc2Cl)cc1)NC1CC1 |
| InChI | InChI=1S/C16H15ClFN3O3S/c17-14-9-10(18)1-8-15(14)25(23,24)21-13-6-4-12(5-7-13)20-16(22)19-11-2-3-11/h1,4-9,11,21H,2-3H2,(H2,19,20,22) |
| InChIKey | XBYUJKPFNOOIBJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |