C16H15N5O3S2 — CID 46534987
1-[4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)phenyl]-3-cyclopropylurea (PubChem CID 46534987) has the molecular formula C16H15N5O3S2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 1-[4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)phenyl]-3-cyclopropylurea.
| Compound Name | 1-[4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)phenyl]-3-cyclopropylurea |
|---|---|
| PubChem CID | 46534987 |
| Molecular Formula | C16H15N5O3S2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 1-[4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)phenyl]-3-cyclopropylurea |
| SMILES | O=C(Nc1ccc(NS(=O)(=O)c2cccc3nsnc23)cc1)NC1CC1 |
| InChI | InChI=1S/C16H15N5O3S2/c22-16(17-10-4-5-10)18-11-6-8-12(9-7-11)21-26(23,24)14-3-1-2-13-15(14)20-25-19-13/h1-3,6-10,21H,4-5H2,(H2,17,18,22) |
| InChIKey | XKAJZVROADINFP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|