C15H11N5O3S3 — CID 20971892
N-[5-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-1,3-benzothiazol-2-yl]acetamide (PubChem CID 20971892) has the molecular formula C15H11N5O3S3 and a molecular weight of 405.49 g/mol. Its IUPAC name is N-[5-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-1,3-benzothiazol-2-yl]acetamide.
| Compound Name | N-[5-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-1,3-benzothiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 20971892 |
| Molecular Formula | C15H11N5O3S3 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.00 |
| IUPAC Name | N-[5-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-1,3-benzothiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc2cc(NS(=O)(=O)c3cccc4nsnc34)ccc2s1 |
| InChI | InChI=1S/C15H11N5O3S3/c1-8(21)16-15-17-11-7-9(5-6-12(11)24-15)20-26(22,23)13-4-2-3-10-14(13)19-25-18-10/h2-7,20H,1H3,(H,16,17,21) |
| InChIKey | LDWXFDVTCANWMR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|