C13H12N4O2S2 — CID 43343951
N-(3-amino-4-methylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 43343951) has the molecular formula C13H12N4O2S2 and a molecular weight of 320.40 g/mol. Its IUPAC name is N-(3-amino-4-methylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-(3-amino-4-methylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 43343951 |
| Molecular Formula | C13H12N4O2S2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | N-(3-amino-4-methylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cccc3nsnc23)cc1N |
| InChI | InChI=1S/C13H12N4O2S2/c1-8-5-6-9(7-10(8)14)17-21(18,19)12-4-2-3-11-13(12)16-20-15-11/h2-7,17H,14H2,1H3 |
| InChIKey | DGRIAPMRYIKKBP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|