C12H5F4N3O2S2 — CID 22774605
N-(2,3,5,6-tetrafluorophenyl)-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 22774605) has the molecular formula C12H5F4N3O2S2 and a molecular weight of 363.32 g/mol. Its IUPAC name is N-(2,3,5,6-tetrafluorophenyl)-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-(2,3,5,6-tetrafluorophenyl)-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 22774605 |
| Molecular Formula | C12H5F4N3O2S2 |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | N-(2,3,5,6-tetrafluorophenyl)-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | O=S(=O)(Nc1c(F)c(F)cc(F)c1F)c1cccc2nsnc12 |
| InChI | InChI=1S/C12H5F4N3O2S2/c13-5-4-6(14)10(16)12(9(5)15)19-23(20,21)8-3-1-2-7-11(8)18-22-17-7/h1-4,19H |
| InChIKey | HAJSUNXTMBAJEY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|