C13H11N3O2S3 — CID 22775212
N-(2-methylsulfanylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 22775212) has the molecular formula C13H11N3O2S3 and a molecular weight of 337.45 g/mol. Its IUPAC name is N-(2-methylsulfanylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-(2-methylsulfanylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 22775212 |
| Molecular Formula | C13H11N3O2S3 |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | N-(2-methylsulfanylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | CSc1ccccc1NS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C13H11N3O2S3/c1-19-11-7-3-2-5-9(11)16-21(17,18)12-8-4-6-10-13(12)15-20-14-10/h2-8,16H,1H3 |
| InChIKey | BJEUNNRQISTTCE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|