C12H9ClN4O2S2 — CID 43343945
N-(2-amino-5-chlorophenyl)-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 43343945) has the molecular formula C12H9ClN4O2S2 and a molecular weight of 340.82 g/mol. Its IUPAC name is N-(2-amino-5-chlorophenyl)-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-(2-amino-5-chlorophenyl)-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 43343945 |
| Molecular Formula | C12H9ClN4O2S2 |
| Molecular Weight | 340.82 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | N-(2-amino-5-chlorophenyl)-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | Nc1ccc(Cl)cc1NS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C12H9ClN4O2S2/c13-7-4-5-8(14)10(6-7)17-21(18,19)11-3-1-2-9-12(11)16-20-15-9/h1-6,17H,14H2 |
| InChIKey | IKBATRAIEWSTST-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.82 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|