C20H13ClF2N4O3S2 — CID 11167847
2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-chloro-N-[(2,4-difluorophenyl)methyl]benzamide (PubChem CID 11167847) has the molecular formula C20H13ClF2N4O3S2 and a molecular weight of 494.93 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-chloro-N-[(2,4-difluorophenyl)methyl]benzamide.
| Compound Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-chloro-N-[(2,4-difluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 11167847 |
| Molecular Formula | C20H13ClF2N4O3S2 |
| Molecular Weight | 494.93 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-chloro-N-[(2,4-difluorophenyl)methyl]benzamide |
| SMILES | O=C(NCc1ccc(F)cc1F)c1ccc(Cl)cc1NS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C20H13ClF2N4O3S2/c21-12-5-7-14(20(28)24-10-11-4-6-13(22)9-15(11)23)17(8-12)27-32(29,30)18-3-1-2-16-19(18)26-31-25-16/h1-9,27H,10H2,(H,24,28) |
| InChIKey | DJSCJPVALBHVOD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.93 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|