C22H15Cl3N4O6S2 — CID 142688441
2-amino-2-[2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-chlorobenzoyl]-3-(3,4-dichlorophenyl)-3-hydroxypropanoic acid (PubChem CID 142688441) has the molecular formula C22H15Cl3N4O6S2 and a molecular weight of 601.88 g/mol. Its IUPAC name is 2-amino-2-[2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-chlorobenzoyl]-3-(3,4-dichlorophenyl)-3-hydroxypropanoic acid.
| Compound Name | 2-amino-2-[2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-chlorobenzoyl]-3-(3,4-dichlorophenyl)-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 142688441 |
| Molecular Formula | C22H15Cl3N4O6S2 |
| Molecular Weight | 601.88 g/mol |
| Exact Mass | 599.95 |
| IUPAC Name | 2-amino-2-[2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-chlorobenzoyl]-3-(3,4-dichlorophenyl)-3-hydroxypropanoic acid |
| SMILES | NC(C(=O)O)(C(=O)c1ccc(Cl)cc1NS(=O)(=O)c1cccc2nsnc12)C(O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H15Cl3N4O6S2/c23-11-5-6-12(16(9-11)29-37(34,35)17-3-1-2-15-18(17)28-36-27-15)20(31)22(26,21(32)33)19(30)10-4-7-13(24)14(25)8-10/h1-9,19,29-30H,26H2,(H,32,33) |
| InChIKey | NQHASEYUPABXJA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 172.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.88 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|