C20H14Cl2N4O3S2 — CID 25014170
2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-chloro-N-[(4-chlorophenyl)methyl]benzamide (PubChem CID 25014170) has the molecular formula C20H14Cl2N4O3S2 and a molecular weight of 493.40 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-chloro-N-[(4-chlorophenyl)methyl]benzamide.
| Compound Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-chloro-N-[(4-chlorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 25014170 |
| Molecular Formula | C20H14Cl2N4O3S2 |
| Molecular Weight | 493.40 g/mol |
| Exact Mass | 491.99 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-chloro-N-[(4-chlorophenyl)methyl]benzamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1ccc(Cl)cc1NS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C20H14Cl2N4O3S2/c21-13-6-4-12(5-7-13)11-23-20(27)15-9-8-14(22)10-17(15)26-31(28,29)18-3-1-2-16-19(18)25-30-24-16/h1-10,26H,11H2,(H,23,27) |
| InChIKey | RLLJWCMENGJOIY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|