C19H13Cl3N4O3S2 — CID 143366399
2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-5-chloro-N-(3,4-dichlorocyclohexa-1,3-dien-1-yl)benzamide (PubChem CID 143366399) has the molecular formula C19H13Cl3N4O3S2 and a molecular weight of 515.83 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-5-chloro-N-(3,4-dichlorocyclohexa-1,3-dien-1-yl)benzamide.
| Compound Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-5-chloro-N-(3,4-dichlorocyclohexa-1,3-dien-1-yl)benzamide |
|---|---|
| PubChem CID | 143366399 |
| Molecular Formula | C19H13Cl3N4O3S2 |
| Molecular Weight | 515.83 g/mol |
| Exact Mass | 513.95 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-5-chloro-N-(3,4-dichlorocyclohexa-1,3-dien-1-yl)benzamide |
| SMILES | O=C(NC1=CC(Cl)=C(Cl)CC1)c1cc(Cl)ccc1NS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C19H13Cl3N4O3S2/c20-10-4-7-15(12(8-10)19(27)23-11-5-6-13(21)14(22)9-11)26-31(28,29)17-3-1-2-16-18(17)25-30-24-16/h1-4,7-9,26H,5-6H2,(H,23,27) |
| InChIKey | WONUJPCHXAQXKL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.83 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|