C13H9IN4O3S2 — CID 141141164
2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-iodobenzamide (PubChem CID 141141164) has the molecular formula C13H9IN4O3S2 and a molecular weight of 460.28 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-iodobenzamide.
| Compound Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-iodobenzamide |
|---|---|
| PubChem CID | 141141164 |
| Molecular Formula | C13H9IN4O3S2 |
| Molecular Weight | 460.28 g/mol |
| Exact Mass | 459.92 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-iodobenzamide |
| SMILES | NC(=O)c1ccc(I)cc1NS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C13H9IN4O3S2/c14-7-4-5-8(13(15)19)10(6-7)18-23(20,21)11-3-1-2-9-12(11)17-22-16-9/h1-6,18H,(H2,15,19) |
| InChIKey | KCLYQELGHQUNJW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|