C22H18ClIN4O4S2 — CID 11549073
2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-[(1S,2R)-1-(4-chlorophenyl)-1-hydroxypropan-2-yl]-4-iodobenzamide (PubChem CID 11549073) has the molecular formula C22H18ClIN4O4S2 and a molecular weight of 628.90 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-[(1S,2R)-1-(4-chlorophenyl)-1-hydroxypropan-2-yl]-4-iodobenzamide.
| Compound Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-[(1S,2R)-1-(4-chlorophenyl)-1-hydroxypropan-2-yl]-4-iodobenzamide |
|---|---|
| PubChem CID | 11549073 |
| Molecular Formula | C22H18ClIN4O4S2 |
| Molecular Weight | 628.90 g/mol |
| Exact Mass | 627.95 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-[(1S,2R)-1-(4-chlorophenyl)-1-hydroxypropan-2-yl]-4-iodobenzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(I)cc1NS(=O)(=O)c1cccc2nsnc12)[C@@H](O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H18ClIN4O4S2/c1-12(21(29)13-5-7-14(23)8-6-13)25-22(30)16-10-9-15(24)11-18(16)28-34(31,32)19-4-2-3-17-20(19)27-33-26-17/h2-12,21,28-29H,1H3,(H,25,30)/t12-,21-/m1/s1 |
| InChIKey | BJMAONDXEDEBJR-XUSGNXJCSA-N |
| XLogP | 4.60 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.90 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|