C23H17Cl2IN4O3S — CID 67199570
N-[1-(2,4-dichlorophenyl)ethyl]-4-iodo-2-(quinoxalin-5-ylsulfonylamino)benzamide (PubChem CID 67199570) has the molecular formula C23H17Cl2IN4O3S and a molecular weight of 627.29 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]-4-iodo-2-(quinoxalin-5-ylsulfonylamino)benzamide.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]-4-iodo-2-(quinoxalin-5-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 67199570 |
| Molecular Formula | C23H17Cl2IN4O3S |
| Molecular Weight | 627.29 g/mol |
| Exact Mass | 625.94 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]-4-iodo-2-(quinoxalin-5-ylsulfonylamino)benzamide |
| SMILES | CC(NC(=O)c1ccc(I)cc1NS(=O)(=O)c1cccc2nccnc12)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H17Cl2IN4O3S/c1-13(16-7-5-14(24)11-18(16)25)29-23(31)17-8-6-15(26)12-20(17)30-34(32,33)21-4-2-3-19-22(21)28-10-9-27-19/h2-13,30H,1H3,(H,29,31) |
| InChIKey | CFLXKIUTBNLQAK-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.29 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|