C24H18ClIN4O5S — CID 58999898
3-(4-chlorophenyl)-2-[[4-iodo-2-(quinoxalin-5-ylsulfonylamino)benzoyl]amino]propanoic acid (PubChem CID 58999898) has the molecular formula C24H18ClIN4O5S and a molecular weight of 636.86 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-[[4-iodo-2-(quinoxalin-5-ylsulfonylamino)benzoyl]amino]propanoic acid.
| Compound Name | 3-(4-chlorophenyl)-2-[[4-iodo-2-(quinoxalin-5-ylsulfonylamino)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 58999898 |
| Molecular Formula | C24H18ClIN4O5S |
| Molecular Weight | 636.86 g/mol |
| Exact Mass | 635.97 |
| IUPAC Name | 3-(4-chlorophenyl)-2-[[4-iodo-2-(quinoxalin-5-ylsulfonylamino)benzoyl]amino]propanoic acid |
| SMILES | O=C(NC(Cc1ccc(Cl)cc1)C(=O)O)c1ccc(I)cc1NS(=O)(=O)c1cccc2nccnc12 |
| InChI | InChI=1S/C24H18ClIN4O5S/c25-15-6-4-14(5-7-15)12-20(24(32)33)29-23(31)17-9-8-16(26)13-19(17)30-36(34,35)21-3-1-2-18-22(21)28-11-10-27-18/h1-11,13,20,30H,12H2,(H,29,31)(H,32,33) |
| InChIKey | QXWMXHMAWCOOGN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 138.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.86 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|