C26H20IN5O5S — CID 89318237
(2S)-3-(3-cyanophenyl)-2-[[4-(iodomethyl)-2-(quinoxalin-5-ylsulfonylamino)benzoyl]amino]propanoic acid (PubChem CID 89318237) has the molecular formula C26H20IN5O5S and a molecular weight of 641.45 g/mol. Its IUPAC name is (2S)-3-(3-cyanophenyl)-2-[[4-(iodomethyl)-2-(quinoxalin-5-ylsulfonylamino)benzoyl]amino]propanoic acid.
| Compound Name | (2S)-3-(3-cyanophenyl)-2-[[4-(iodomethyl)-2-(quinoxalin-5-ylsulfonylamino)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 89318237 |
| Molecular Formula | C26H20IN5O5S |
| Molecular Weight | 641.45 g/mol |
| Exact Mass | 641.02 |
| IUPAC Name | (2S)-3-(3-cyanophenyl)-2-[[4-(iodomethyl)-2-(quinoxalin-5-ylsulfonylamino)benzoyl]amino]propanoic acid |
| SMILES | N#Cc1cccc(C[C@H](NC(=O)c2ccc(CI)cc2NS(=O)(=O)c2cccc3nccnc23)C(=O)O)c1 |
| InChI | InChI=1S/C26H20IN5O5S/c27-14-17-7-8-19(25(33)31-22(26(34)35)12-16-3-1-4-18(11-16)15-28)21(13-17)32-38(36,37)23-6-2-5-20-24(23)30-10-9-29-20/h1-11,13,22,32H,12,14H2,(H,31,33)(H,34,35)/t22-/m0/s1 |
| InChIKey | IDIDPKHAVZFRKZ-QFIPXVFZSA-N |
| XLogP | 3.66 |
| TPSA | 162.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|