C21H17ClN4O3S2 — CID 58906281
2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-chloro-N-[(2-methylphenyl)methyl]benzamide (PubChem CID 58906281) has the molecular formula C21H17ClN4O3S2 and a molecular weight of 472.98 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-chloro-N-[(2-methylphenyl)methyl]benzamide.
| Compound Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-chloro-N-[(2-methylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 58906281 |
| Molecular Formula | C21H17ClN4O3S2 |
| Molecular Weight | 472.98 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-chloro-N-[(2-methylphenyl)methyl]benzamide |
| SMILES | Cc1ccccc1CNC(=O)c1ccc(Cl)cc1NS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C21H17ClN4O3S2/c1-13-5-2-3-6-14(13)12-23-21(27)16-10-9-15(22)11-18(16)26-31(28,29)19-8-4-7-17-20(19)25-30-24-17/h2-11,26H,12H2,1H3,(H,23,27) |
| InChIKey | JUQCZKWGGYXPGF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.98 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|