C14H10FN3O4S2 — CID 67202118
methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-fluorobenzoate (PubChem CID 67202118) has the molecular formula C14H10FN3O4S2 and a molecular weight of 367.38 g/mol. Its IUPAC name is methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-fluorobenzoate.
| Compound Name | methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-fluorobenzoate |
|---|---|
| PubChem CID | 67202118 |
| Molecular Formula | C14H10FN3O4S2 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | methyl 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-fluorobenzoate |
| SMILES | COC(=O)c1ccc(F)cc1NS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C14H10FN3O4S2/c1-22-14(19)9-6-5-8(15)7-11(9)18-24(20,21)12-4-2-3-10-13(12)17-23-16-10/h2-7,18H,1H3 |
| InChIKey | WBPZSOUQBDBAEN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|