About methyl 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-hydroxybenzoate
methyl 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-hydroxybenzoate (PubChem CID 71612164) has the molecular formula C14H11N3O5S2
and a molecular weight of 365.39 g/mol. Its IUPAC name is methyl 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-hydroxybenzoate.
Molecular Properties
| Compound Name | methyl 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-hydroxybenzoate |
| PubChem CID | 71612164 |
| Molecular Formula | C14H11N3O5S2 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | methyl 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(NS(=O)(=O)c2cccc3nsnc23)cc1O |
| InChI | InChI=1S/C14H11N3O5S2/c1-22-14(19)9-6-5-8(7-11(9)18)17-24(20,21)12-4-2-3-10-13(12)16-23-15-10/h2-7,17-18H,1H3 |
| InChIKey | JFFYDPBOOFUOCD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-hydroxybenzoate?
The IUPAC name of methyl 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-hydroxybenzoate (CID 71612164) is methyl 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-hydroxybenzoate.
What is the SMILES notation for methyl 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-hydroxybenzoate?
The canonical SMILES for methyl 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-hydroxybenzoate is COC(=O)c1ccc(NS(=O)(=O)c2cccc3nsnc23)cc1O.
What is the InChIKey of methyl 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-hydroxybenzoate?
The InChIKey is JFFYDPBOOFUOCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O5S2/c1-22-14(19)9-6-5-8(7-11(9)18)17-24(20,21)12-4-2-3-10-13(12)16-23-15-10/h2-7,17-18H,1H3.
What are the key properties of methyl 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-hydroxybenzoate?
methyl 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-hydroxybenzoate has a molecular weight of 365.39 g/mol, XLogP of 1.98, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-hydroxybenzoate is sourced from PubChem (CID 71612164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).