C14H11N3O5S2 — CID 71612164
methyl 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-hydroxybenzoate (PubChem CID 71612164) has the molecular formula C14H11N3O5S2 and a molecular weight of 365.39 g/mol. Its IUPAC name is methyl 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-hydroxybenzoate.
| Compound Name | methyl 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-hydroxybenzoate |
|---|---|
| PubChem CID | 71612164 |
| Molecular Formula | C14H11N3O5S2 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | methyl 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-2-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(NS(=O)(=O)c2cccc3nsnc23)cc1O |
| InChI | InChI=1S/C14H11N3O5S2/c1-22-14(19)9-6-5-8(7-11(9)18)17-24(20,21)12-4-2-3-10-13(12)16-23-15-10/h2-7,17-18H,1H3 |
| InChIKey | JFFYDPBOOFUOCD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|