C18H17N3O6S2 — CID 22773021
diethyl 5-(2,1,3-benzothiadiazol-4-ylsulfonylamino)benzene-1,3-dicarboxylate (PubChem CID 22773021) has the molecular formula C18H17N3O6S2 and a molecular weight of 435.48 g/mol. Its IUPAC name is diethyl 5-(2,1,3-benzothiadiazol-4-ylsulfonylamino)benzene-1,3-dicarboxylate.
| Compound Name | diethyl 5-(2,1,3-benzothiadiazol-4-ylsulfonylamino)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 22773021 |
| Molecular Formula | C18H17N3O6S2 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | diethyl 5-(2,1,3-benzothiadiazol-4-ylsulfonylamino)benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(NS(=O)(=O)c2cccc3nsnc23)cc(C(=O)OCC)c1 |
| InChI | InChI=1S/C18H17N3O6S2/c1-3-26-17(22)11-8-12(18(23)27-4-2)10-13(9-11)21-29(24,25)15-7-5-6-14-16(15)20-28-19-14/h5-10,21H,3-4H2,1-2H3 |
| InChIKey | HZZBPHGAGUANCR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|