C16H15N3O4S2 — CID 5302755
ethyl 4-[(5-methyl-2,1,3-benzothiadiazol-4-yl)sulfonylamino]benzoate (PubChem CID 5302755) has the molecular formula C16H15N3O4S2 and a molecular weight of 377.45 g/mol. Its IUPAC name is ethyl 4-[(5-methyl-2,1,3-benzothiadiazol-4-yl)sulfonylamino]benzoate.
| Compound Name | ethyl 4-[(5-methyl-2,1,3-benzothiadiazol-4-yl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 5302755 |
| Molecular Formula | C16H15N3O4S2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | ethyl 4-[(5-methyl-2,1,3-benzothiadiazol-4-yl)sulfonylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NS(=O)(=O)c2c(C)ccc3nsnc23)cc1 |
| InChI | InChI=1S/C16H15N3O4S2/c1-3-23-16(20)11-5-7-12(8-6-11)19-25(21,22)15-10(2)4-9-13-14(15)18-24-17-13/h4-9,19H,3H2,1-2H3 |
| InChIKey | JYYHGYWXOUYHQM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|