C18H21NO5S — CID 2236611
ethyl 4-[(5-methoxy-2,4-dimethylphenyl)sulfonylamino]benzoate (PubChem CID 2236611) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is ethyl 4-[(5-methoxy-2,4-dimethylphenyl)sulfonylamino]benzoate.
| Compound Name | ethyl 4-[(5-methoxy-2,4-dimethylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 2236611 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | ethyl 4-[(5-methoxy-2,4-dimethylphenyl)sulfonylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NS(=O)(=O)c2cc(OC)c(C)cc2C)cc1 |
| InChI | InChI=1S/C18H21NO5S/c1-5-24-18(20)14-6-8-15(9-7-14)19-25(21,22)17-11-16(23-4)12(2)10-13(17)3/h6-11,19H,5H2,1-4H3 |
| InChIKey | UZDUEPBQSVIOQB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |