C18H19N5O5S — CID 1204216
ethyl 4-[[2-methoxy-5-(1-methyltetrazol-5-yl)phenyl]sulfonylamino]benzoate (PubChem CID 1204216) has the molecular formula C18H19N5O5S and a molecular weight of 417.45 g/mol. Its IUPAC name is ethyl 4-[[2-methoxy-5-(1-methyltetrazol-5-yl)phenyl]sulfonylamino]benzoate.
| Compound Name | ethyl 4-[[2-methoxy-5-(1-methyltetrazol-5-yl)phenyl]sulfonylamino]benzoate |
|---|---|
| PubChem CID | 1204216 |
| Molecular Formula | C18H19N5O5S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | ethyl 4-[[2-methoxy-5-(1-methyltetrazol-5-yl)phenyl]sulfonylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NS(=O)(=O)c2cc(-c3nnnn3C)ccc2OC)cc1 |
| InChI | InChI=1S/C18H19N5O5S/c1-4-28-18(24)12-5-8-14(9-6-12)20-29(25,26)16-11-13(7-10-15(16)27-3)17-19-21-22-23(17)2/h5-11,20H,4H2,1-3H3 |
| InChIKey | YBARWGMKSXZZEK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |