C18H20N6O4S — CID 25049417
N-[4-[[5-(1-ethyltetrazol-5-yl)-2-methoxyphenyl]sulfonylamino]phenyl]acetamide (PubChem CID 25049417) has the molecular formula C18H20N6O4S and a molecular weight of 416.46 g/mol. Its IUPAC name is N-[4-[[5-(1-ethyltetrazol-5-yl)-2-methoxyphenyl]sulfonylamino]phenyl]acetamide.
| Compound Name | N-[4-[[5-(1-ethyltetrazol-5-yl)-2-methoxyphenyl]sulfonylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 25049417 |
| Molecular Formula | C18H20N6O4S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N-[4-[[5-(1-ethyltetrazol-5-yl)-2-methoxyphenyl]sulfonylamino]phenyl]acetamide |
| SMILES | CCn1nnnc1-c1ccc(OC)c(S(=O)(=O)Nc2ccc(NC(C)=O)cc2)c1 |
| InChI | InChI=1S/C18H20N6O4S/c1-4-24-18(20-22-23-24)13-5-10-16(28-3)17(11-13)29(26,27)21-15-8-6-14(7-9-15)19-12(2)25/h5-11,21H,4H2,1-3H3,(H,19,25) |
| InChIKey | MWEWJLYQXQJMEZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |