C22H28N2O6S — CID 56548086
ethyl 2-[[4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzoyl]-propan-2-ylamino]acetate (PubChem CID 56548086) has the molecular formula C22H28N2O6S and a molecular weight of 448.54 g/mol. Its IUPAC name is ethyl 2-[[4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzoyl]-propan-2-ylamino]acetate.
| Compound Name | ethyl 2-[[4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzoyl]-propan-2-ylamino]acetate |
|---|---|
| PubChem CID | 56548086 |
| Molecular Formula | C22H28N2O6S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | ethyl 2-[[4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzoyl]-propan-2-ylamino]acetate |
| SMILES | CCOC(=O)CN(C(=O)c1ccc(OC)c(S(=O)(=O)Nc2ccc(C)cc2)c1)C(C)C |
| InChI | InChI=1S/C22H28N2O6S/c1-6-30-21(25)14-24(15(2)3)22(26)17-9-12-19(29-5)20(13-17)31(27,28)23-18-10-7-16(4)8-11-18/h7-13,15,23H,6,14H2,1-5H3 |
| InChIKey | OESYVBJTQLKDEG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |