C20H25N3O5S — CID 9300536
4-methoxy-3-[(4-methylphenyl)sulfamoyl]-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide (PubChem CID 9300536) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is 4-methoxy-3-[(4-methylphenyl)sulfamoyl]-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide.
| Compound Name | 4-methoxy-3-[(4-methylphenyl)sulfamoyl]-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 9300536 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 4-methoxy-3-[(4-methylphenyl)sulfamoyl]-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCC(=O)NC(C)C)cc1S(=O)(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C20H25N3O5S/c1-13(2)22-19(24)12-21-20(25)15-7-10-17(28-4)18(11-15)29(26,27)23-16-8-5-14(3)6-9-16/h5-11,13,23H,12H2,1-4H3,(H,21,25)(H,22,24) |
| InChIKey | ZSZUOXSHDIIEHQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |