C23H26N2O4S2 — CID 46613291
4-methoxy-3-[(4-methylphenyl)sulfamoyl]-N-(2-methyl-1-thiophen-2-ylpropyl)benzamide (PubChem CID 46613291) has the molecular formula C23H26N2O4S2 and a molecular weight of 458.61 g/mol. Its IUPAC name is 4-methoxy-3-[(4-methylphenyl)sulfamoyl]-N-(2-methyl-1-thiophen-2-ylpropyl)benzamide.
| Compound Name | 4-methoxy-3-[(4-methylphenyl)sulfamoyl]-N-(2-methyl-1-thiophen-2-ylpropyl)benzamide |
|---|---|
| PubChem CID | 46613291 |
| Molecular Formula | C23H26N2O4S2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 4-methoxy-3-[(4-methylphenyl)sulfamoyl]-N-(2-methyl-1-thiophen-2-ylpropyl)benzamide |
| SMILES | COc1ccc(C(=O)NC(c2cccs2)C(C)C)cc1S(=O)(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C23H26N2O4S2/c1-15(2)22(20-6-5-13-30-20)24-23(26)17-9-12-19(29-4)21(14-17)31(27,28)25-18-10-7-16(3)8-11-18/h5-15,22,25H,1-4H3,(H,24,26) |
| InChIKey | JVVMPLDSNHZBAN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |