C22H21N3O6S — CID 55370417
5-[[(2-hydroxybenzoyl)amino]carbamoyl]-2-methoxy-N-(4-methylphenyl)benzenesulfonamide (PubChem CID 55370417) has the molecular formula C22H21N3O6S and a molecular weight of 455.49 g/mol. Its IUPAC name is 5-[[(2-hydroxybenzoyl)amino]carbamoyl]-2-methoxy-N-(4-methylphenyl)benzenesulfonamide.
| Compound Name | 5-[[(2-hydroxybenzoyl)amino]carbamoyl]-2-methoxy-N-(4-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 55370417 |
| Molecular Formula | C22H21N3O6S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 5-[[(2-hydroxybenzoyl)amino]carbamoyl]-2-methoxy-N-(4-methylphenyl)benzenesulfonamide |
| SMILES | COc1ccc(C(=O)NNC(=O)c2ccccc2O)cc1S(=O)(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C22H21N3O6S/c1-14-7-10-16(11-8-14)25-32(29,30)20-13-15(9-12-19(20)31-2)21(27)23-24-22(28)17-5-3-4-6-18(17)26/h3-13,25-26H,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | LWHXYXLFXDAYFA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|