C25H25NO7S — CID 43004687
(5-acetyl-2-methoxyphenyl)methyl 4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzoate (PubChem CID 43004687) has the molecular formula C25H25NO7S and a molecular weight of 483.54 g/mol. Its IUPAC name is (5-acetyl-2-methoxyphenyl)methyl 4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzoate.
| Compound Name | (5-acetyl-2-methoxyphenyl)methyl 4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 43004687 |
| Molecular Formula | C25H25NO7S |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | (5-acetyl-2-methoxyphenyl)methyl 4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzoate |
| SMILES | COc1ccc(C(C)=O)cc1COC(=O)c1ccc(OC)c(S(=O)(=O)Nc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C25H25NO7S/c1-16-5-9-21(10-6-16)26-34(29,30)24-14-19(8-12-23(24)32-4)25(28)33-15-20-13-18(17(2)27)7-11-22(20)31-3/h5-14,26H,15H2,1-4H3 |
| InChIKey | OLIGQNNMBUEPNZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |