C25H23N3O6S — CID 55304491
[2-[N-(cyanomethyl)anilino]-2-oxoethyl] 4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzoate (PubChem CID 55304491) has the molecular formula C25H23N3O6S and a molecular weight of 493.54 g/mol. Its IUPAC name is [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzoate.
| Compound Name | [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 55304491 |
| Molecular Formula | C25H23N3O6S |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)N(CC#N)c2ccccc2)cc1S(=O)(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C25H23N3O6S/c1-18-8-11-20(12-9-18)27-35(31,32)23-16-19(10-13-22(23)33-2)25(30)34-17-24(29)28(15-14-26)21-6-4-3-5-7-21/h3-13,16,27H,15,17H2,1-2H3 |
| InChIKey | PIPVYVCVTNNYHD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|