C19H18N2O3 — CID 8535655
[2-[N-(cyanomethyl)anilino]-2-oxoethyl] 3,5-dimethylbenzoate (PubChem CID 8535655) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 3,5-dimethylbenzoate.
| Compound Name | [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 8535655 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 3,5-dimethylbenzoate |
| SMILES | Cc1cc(C)cc(C(=O)OCC(=O)N(CC#N)c2ccccc2)c1 |
| InChI | InChI=1S/C19H18N2O3/c1-14-10-15(2)12-16(11-14)19(23)24-13-18(22)21(9-8-20)17-6-4-3-5-7-17/h3-7,10-12H,9,13H2,1-2H3 |
| InChIKey | YOVDRNKGUYPDGQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|