C18H16N2O4 — CID 7985868
[2-[N-(cyanomethyl)anilino]-2-oxoethyl] 3-methoxybenzoate (PubChem CID 7985868) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 3-methoxybenzoate.
| Compound Name | [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 7985868 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)OCC(=O)N(CC#N)c2ccccc2)c1 |
| InChI | InChI=1S/C18H16N2O4/c1-23-16-9-5-6-14(12-16)18(22)24-13-17(21)20(11-10-19)15-7-3-2-4-8-15/h2-9,12H,11,13H2,1H3 |
| InChIKey | RAASQFNRXBMPFQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|