C24H23N3O6 — CID 31101751
[2-[N-(cyanomethyl)anilino]-2-oxoethyl] 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxybenzoate (PubChem CID 31101751) has the molecular formula C24H23N3O6 and a molecular weight of 449.46 g/mol. Its IUPAC name is [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxybenzoate.
| Compound Name | [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxybenzoate |
|---|---|
| PubChem CID | 31101751 |
| Molecular Formula | C24H23N3O6 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)N(CC#N)c2ccccc2)ccc1OCc1c(C)noc1C |
| InChI | InChI=1S/C24H23N3O6/c1-16-20(17(2)33-26-16)14-31-21-10-9-18(13-22(21)30-3)24(29)32-15-23(28)27(12-11-25)19-7-5-4-6-8-19/h4-10,13H,12,14-15H2,1-3H3 |
| InChIKey | IAKDSTOTEZRJRW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 114.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|