C23H21N3O5 — CID 31105164
[2-[N-(cyanomethyl)anilino]-2-oxoethyl] 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoate (PubChem CID 31105164) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoate.
| Compound Name | [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoate |
|---|---|
| PubChem CID | 31105164 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoate |
| SMILES | Cc1noc(C)c1COc1ccccc1C(=O)OCC(=O)N(CC#N)c1ccccc1 |
| InChI | InChI=1S/C23H21N3O5/c1-16-20(17(2)31-25-16)14-29-21-11-7-6-10-19(21)23(28)30-15-22(27)26(13-12-24)18-8-4-3-5-9-18/h3-11H,13-15H2,1-2H3 |
| InChIKey | GUOFKADUYAPCTF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 105.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|