C16H17N3O2S — CID 112777798
N-(cyanomethyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N-phenylacetamide (PubChem CID 112777798) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N-phenylacetamide.
| Compound Name | N-(cyanomethyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 112777798 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | N-(cyanomethyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N-phenylacetamide |
| SMILES | Cc1noc(C)c1CSCC(=O)N(CC#N)c1ccccc1 |
| InChI | InChI=1S/C16H17N3O2S/c1-12-15(13(2)21-18-12)10-22-11-16(20)19(9-8-17)14-6-4-3-5-7-14/h3-7H,9-11H2,1-2H3 |
| InChIKey | BSZKGOHGUIETKM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 70.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|