C23H23NO6S — CID 16619379
(3-methoxyphenyl)methyl 4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzoate (PubChem CID 16619379) has the molecular formula C23H23NO6S and a molecular weight of 441.51 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl 4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzoate.
| Compound Name | (3-methoxyphenyl)methyl 4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 16619379 |
| Molecular Formula | C23H23NO6S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | (3-methoxyphenyl)methyl 4-methoxy-3-[(4-methylphenyl)sulfamoyl]benzoate |
| SMILES | COc1cccc(COC(=O)c2ccc(OC)c(S(=O)(=O)Nc3ccc(C)cc3)c2)c1 |
| InChI | InChI=1S/C23H23NO6S/c1-16-7-10-19(11-8-16)24-31(26,27)22-14-18(9-12-21(22)29-3)23(25)30-15-17-5-4-6-20(13-17)28-2/h4-14,24H,15H2,1-3H3 |
| InChIKey | HSEXWUQJAVSTTQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |