About (4-methylphenyl)methyl 3-(dimethylsulfamoyl)-4-methoxybenzoate
(4-methylphenyl)methyl 3-(dimethylsulfamoyl)-4-methoxybenzoate (PubChem CID 7973283) has the molecular formula C18H21NO5S
and a molecular weight of 363.44 g/mol. Its IUPAC name is (4-methylphenyl)methyl 3-(dimethylsulfamoyl)-4-methoxybenzoate.
Molecular Properties
| Compound Name | (4-methylphenyl)methyl 3-(dimethylsulfamoyl)-4-methoxybenzoate |
| PubChem CID | 7973283 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (4-methylphenyl)methyl 3-(dimethylsulfamoyl)-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCc2ccc(C)cc2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C18H21NO5S/c1-13-5-7-14(8-6-13)12-24-18(20)15-9-10-16(23-4)17(11-15)25(21,22)19(2)3/h5-11H,12H2,1-4H3 |
| InChIKey | NRRPFLDOAWIROV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-methylphenyl)methyl 3-(dimethylsulfamoyl)-4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl)methyl 3-(dimethylsulfamoyl)-4-methoxybenzoate?
The IUPAC name of (4-methylphenyl)methyl 3-(dimethylsulfamoyl)-4-methoxybenzoate (CID 7973283) is (4-methylphenyl)methyl 3-(dimethylsulfamoyl)-4-methoxybenzoate.
What is the SMILES notation for (4-methylphenyl)methyl 3-(dimethylsulfamoyl)-4-methoxybenzoate?
The canonical SMILES for (4-methylphenyl)methyl 3-(dimethylsulfamoyl)-4-methoxybenzoate is COc1ccc(C(=O)OCc2ccc(C)cc2)cc1S(=O)(=O)N(C)C.
What is the InChIKey of (4-methylphenyl)methyl 3-(dimethylsulfamoyl)-4-methoxybenzoate?
The InChIKey is NRRPFLDOAWIROV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO5S/c1-13-5-7-14(8-6-13)12-24-18(20)15-9-10-16(23-4)17(11-15)25(21,22)19(2)3/h5-11H,12H2,1-4H3.
What are the key properties of (4-methylphenyl)methyl 3-(dimethylsulfamoyl)-4-methoxybenzoate?
(4-methylphenyl)methyl 3-(dimethylsulfamoyl)-4-methoxybenzoate has a molecular weight of 363.44 g/mol, XLogP of 2.61, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl)methyl 3-(dimethylsulfamoyl)-4-methoxybenzoate is sourced from PubChem (CID 7973283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).