C15H21NO5S — CID 94448571
[(Z)-pent-2-enyl] 3-(dimethylsulfamoyl)-4-methoxybenzoate (PubChem CID 94448571) has the molecular formula C15H21NO5S and a molecular weight of 327.40 g/mol. Its IUPAC name is [(Z)-pent-2-enyl] 3-(dimethylsulfamoyl)-4-methoxybenzoate.
| Compound Name | [(Z)-pent-2-enyl] 3-(dimethylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 94448571 |
| Molecular Formula | C15H21NO5S |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | [(Z)-pent-2-enyl] 3-(dimethylsulfamoyl)-4-methoxybenzoate |
| SMILES | CC/C=C\COC(=O)c1ccc(OC)c(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C15H21NO5S/c1-5-6-7-10-21-15(17)12-8-9-13(20-4)14(11-12)22(18,19)16(2)3/h6-9,11H,5,10H2,1-4H3/b7-6- |
| InChIKey | DGRTXNVWQLOQKF-SREVYHEPSA-N |
| XLogP | 2.07 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|