C21H27NO5S — CID 7973287
(4-tert-butylphenyl)methyl 3-(dimethylsulfamoyl)-4-methoxybenzoate (PubChem CID 7973287) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is (4-tert-butylphenyl)methyl 3-(dimethylsulfamoyl)-4-methoxybenzoate.
| Compound Name | (4-tert-butylphenyl)methyl 3-(dimethylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 7973287 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | (4-tert-butylphenyl)methyl 3-(dimethylsulfamoyl)-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCc2ccc(C(C)(C)C)cc2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C21H27NO5S/c1-21(2,3)17-10-7-15(8-11-17)14-27-20(23)16-9-12-18(26-6)19(13-16)28(24,25)22(4)5/h7-13H,14H2,1-6H3 |
| InChIKey | GIWYMTXSHGDMPS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |