C17H17BrN2O5S — CID 26961474
(4-carbamoylphenyl)methyl 4-bromo-3-(dimethylsulfamoyl)benzoate (PubChem CID 26961474) has the molecular formula C17H17BrN2O5S and a molecular weight of 441.30 g/mol. Its IUPAC name is (4-carbamoylphenyl)methyl 4-bromo-3-(dimethylsulfamoyl)benzoate.
| Compound Name | (4-carbamoylphenyl)methyl 4-bromo-3-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 26961474 |
| Molecular Formula | C17H17BrN2O5S |
| Molecular Weight | 441.30 g/mol |
| Exact Mass | 440.00 |
| IUPAC Name | (4-carbamoylphenyl)methyl 4-bromo-3-(dimethylsulfamoyl)benzoate |
| SMILES | CN(C)S(=O)(=O)c1cc(C(=O)OCc2ccc(C(N)=O)cc2)ccc1Br |
| InChI | InChI=1S/C17H17BrN2O5S/c1-20(2)26(23,24)15-9-13(7-8-14(15)18)17(22)25-10-11-3-5-12(6-4-11)16(19)21/h3-9H,10H2,1-2H3,(H2,19,21) |
| InChIKey | UQWBZYDWKVBHHM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |