C21H23BrN2O5S — CID 32974340
[4-(pyrrolidine-1-carbonyl)phenyl]methyl 4-bromo-3-(dimethylsulfamoyl)benzoate (PubChem CID 32974340) has the molecular formula C21H23BrN2O5S and a molecular weight of 495.40 g/mol. Its IUPAC name is [4-(pyrrolidine-1-carbonyl)phenyl]methyl 4-bromo-3-(dimethylsulfamoyl)benzoate.
| Compound Name | [4-(pyrrolidine-1-carbonyl)phenyl]methyl 4-bromo-3-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 32974340 |
| Molecular Formula | C21H23BrN2O5S |
| Molecular Weight | 495.40 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | [4-(pyrrolidine-1-carbonyl)phenyl]methyl 4-bromo-3-(dimethylsulfamoyl)benzoate |
| SMILES | CN(C)S(=O)(=O)c1cc(C(=O)OCc2ccc(C(=O)N3CCCC3)cc2)ccc1Br |
| InChI | InChI=1S/C21H23BrN2O5S/c1-23(2)30(27,28)19-13-17(9-10-18(19)22)21(26)29-14-15-5-7-16(8-6-15)20(25)24-11-3-4-12-24/h5-10,13H,3-4,11-12,14H2,1-2H3 |
| InChIKey | SLOZUFKCXKYRHW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |