(3-methylphenyl)methyl 4-bromo-3-(dimethylsulfamoyl)benzoate

C17H18BrNO4S — CID 40613741

IUPAC(3-methylphenyl)methyl 4-bromo-3-(dimethylsulfamoyl)benzoate
SMILESCc1cccc(COC(=O)c2ccc(Br)c(S(=O)(=O)N(C)C)c2)c1
InChIInChI=1S/C17H18BrNO4S/c1-12-5-4-6-13(9-12)11-23-17(20)14-7-8-15(18)16(10-14)24(21,22)19(2)3/h4-10H,11H2,1-3H3
InChIKeyQEADXMNVGYMCHB-UHFFFAOYSA-N
MW412.31 g/mol
LogP3.36
Rot. Bonds5

About (3-methylphenyl)methyl 4-bromo-3-(dimethylsulfamoyl)benzoate

(3-methylphenyl)methyl 4-bromo-3-(dimethylsulfamoyl)benzoate (PubChem CID 40613741) has the molecular formula C17H18BrNO4S and a molecular weight of 412.31 g/mol. Its IUPAC name is (3-methylphenyl)methyl 4-bromo-3-(dimethylsulfamoyl)benzoate.

Molecular Properties

Compound Name(3-methylphenyl)methyl 4-bromo-3-(dimethylsulfamoyl)benzoate
PubChem CID40613741
Molecular FormulaC17H18BrNO4S
Molecular Weight412.31 g/mol
Exact Mass411.01
IUPAC Name(3-methylphenyl)methyl 4-bromo-3-(dimethylsulfamoyl)benzoate
SMILESCc1cccc(COC(=O)c2ccc(Br)c(S(=O)(=O)N(C)C)c2)c1
InChIInChI=1S/C17H18BrNO4S/c1-12-5-4-6-13(9-12)11-23-17(20)14-7-8-15(18)16(10-14)24(21,22)19(2)3/h4-10H,11H2,1-3H3
InChIKeyQEADXMNVGYMCHB-UHFFFAOYSA-N
XLogP3.36
TPSA63.68 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500412.31
LogP ≤ 53.36
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (3-methylphenyl)methyl 4-bromo-3-(dimethylsulfamoyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-methylphenyl)methyl 4-bromo-3-(dimethylsulfamoyl)benzoate?
The IUPAC name of (3-methylphenyl)methyl 4-bromo-3-(dimethylsulfamoyl)benzoate (CID 40613741) is (3-methylphenyl)methyl 4-bromo-3-(dimethylsulfamoyl)benzoate.
What is the SMILES notation for (3-methylphenyl)methyl 4-bromo-3-(dimethylsulfamoyl)benzoate?
The canonical SMILES for (3-methylphenyl)methyl 4-bromo-3-(dimethylsulfamoyl)benzoate is Cc1cccc(COC(=O)c2ccc(Br)c(S(=O)(=O)N(C)C)c2)c1.
What is the InChIKey of (3-methylphenyl)methyl 4-bromo-3-(dimethylsulfamoyl)benzoate?
The InChIKey is QEADXMNVGYMCHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18BrNO4S/c1-12-5-4-6-13(9-12)11-23-17(20)14-7-8-15(18)16(10-14)24(21,22)19(2)3/h4-10H,11H2,1-3H3.
What are the key properties of (3-methylphenyl)methyl 4-bromo-3-(dimethylsulfamoyl)benzoate?
(3-methylphenyl)methyl 4-bromo-3-(dimethylsulfamoyl)benzoate has a molecular weight of 412.31 g/mol, XLogP of 3.36, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylphenyl)methyl 4-bromo-3-(dimethylsulfamoyl)benzoate is sourced from PubChem (CID 40613741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).