C20H23NO5S — CID 42980000
(3-methylphenyl)methyl 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 42980000) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is (3-methylphenyl)methyl 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | (3-methylphenyl)methyl 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 42980000 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | (3-methylphenyl)methyl 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | COc1ccc(C(=O)OCc2cccc(C)c2)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C20H23NO5S/c1-15-6-5-7-16(12-15)14-26-20(22)17-8-9-18(25-2)19(13-17)27(23,24)21-10-3-4-11-21/h5-9,12-13H,3-4,10-11,14H2,1-2H3 |
| InChIKey | HJBPBONLMWIOHR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |