C20H20F3NO5S — CID 2594840
[3-(trifluoromethyl)phenyl]methyl 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 2594840) has the molecular formula C20H20F3NO5S and a molecular weight of 443.44 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl]methyl 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [3-(trifluoromethyl)phenyl]methyl 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2594840 |
| Molecular Formula | C20H20F3NO5S |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | [3-(trifluoromethyl)phenyl]methyl 4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | COc1ccc(C(=O)OCc2cccc(C(F)(F)F)c2)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C20H20F3NO5S/c1-28-17-8-7-15(12-18(17)30(26,27)24-9-2-3-10-24)19(25)29-13-14-5-4-6-16(11-14)20(21,22)23/h4-8,11-12H,2-3,9-10,13H2,1H3 |
| InChIKey | HEMHBVOVIKQWGJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |