C17H16F3NO4S2 — CID 46517261
[3-(trifluoromethyl)phenyl]methyl 3-pyrrolidin-1-ylsulfonylthiophene-2-carboxylate (PubChem CID 46517261) has the molecular formula C17H16F3NO4S2 and a molecular weight of 419.45 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl]methyl 3-pyrrolidin-1-ylsulfonylthiophene-2-carboxylate.
| Compound Name | [3-(trifluoromethyl)phenyl]methyl 3-pyrrolidin-1-ylsulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 46517261 |
| Molecular Formula | C17H16F3NO4S2 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | [3-(trifluoromethyl)phenyl]methyl 3-pyrrolidin-1-ylsulfonylthiophene-2-carboxylate |
| SMILES | O=C(OCc1cccc(C(F)(F)F)c1)c1sccc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C17H16F3NO4S2/c18-17(19,20)13-5-3-4-12(10-13)11-25-16(22)15-14(6-9-26-15)27(23,24)21-7-1-2-8-21/h3-6,9-10H,1-2,7-8,11H2 |
| InChIKey | QDYWLTSSZXLOAC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |