C17H19NO6S2 — CID 55456109
(3-methoxyphenyl)methyl 3-morpholin-4-ylsulfonylthiophene-2-carboxylate (PubChem CID 55456109) has the molecular formula C17H19NO6S2 and a molecular weight of 397.47 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl 3-morpholin-4-ylsulfonylthiophene-2-carboxylate.
| Compound Name | (3-methoxyphenyl)methyl 3-morpholin-4-ylsulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 55456109 |
| Molecular Formula | C17H19NO6S2 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | (3-methoxyphenyl)methyl 3-morpholin-4-ylsulfonylthiophene-2-carboxylate |
| SMILES | COc1cccc(COC(=O)c2sccc2S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C17H19NO6S2/c1-22-14-4-2-3-13(11-14)12-24-17(19)16-15(5-10-25-16)26(20,21)18-6-8-23-9-7-18/h2-5,10-11H,6-9,12H2,1H3 |
| InChIKey | CQCMBAFTHQWAND-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |