C20H23NO6S — CID 27010764
(3-methoxyphenyl)methyl 4-methyl-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 27010764) has the molecular formula C20H23NO6S and a molecular weight of 405.47 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl 4-methyl-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | (3-methoxyphenyl)methyl 4-methyl-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 27010764 |
| Molecular Formula | C20H23NO6S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | (3-methoxyphenyl)methyl 4-methyl-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | COc1cccc(COC(=O)c2ccc(C)c(S(=O)(=O)N3CCOCC3)c2)c1 |
| InChI | InChI=1S/C20H23NO6S/c1-15-6-7-17(13-19(15)28(23,24)21-8-10-26-11-9-21)20(22)27-14-16-4-3-5-18(12-16)25-2/h3-7,12-13H,8-11,14H2,1-2H3 |
| InChIKey | GNMJAKGNXYKCCZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |