C21H21F2N3O5S — CID 16624854
[1-(difluoromethyl)benzimidazol-2-yl]methyl 4-methyl-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 16624854) has the molecular formula C21H21F2N3O5S and a molecular weight of 465.48 g/mol. Its IUPAC name is [1-(difluoromethyl)benzimidazol-2-yl]methyl 4-methyl-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl 4-methyl-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16624854 |
| Molecular Formula | C21H21F2N3O5S |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl 4-methyl-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | Cc1ccc(C(=O)OCc2nc3ccccc3n2C(F)F)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H21F2N3O5S/c1-14-6-7-15(12-18(14)32(28,29)25-8-10-30-11-9-25)20(27)31-13-19-24-16-4-2-3-5-17(16)26(19)21(22)23/h2-7,12,21H,8-11,13H2,1H3 |
| InChIKey | PSZKJDOONXXBRO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |